About 4-ethoxyphenol isocyanate
4-ethoxyphenol isocyanate (PubChem CID 20557311) has the molecular formula C9H10NO3-
and a molecular weight of 180.18 g/mol. Its IUPAC name is 4-ethoxyphenol isocyanate.
Molecular Properties
| Compound Name | 4-ethoxyphenol isocyanate |
| PubChem CID | 20557311 |
| Molecular Formula | C9H10NO3- |
| Molecular Weight | 180.18 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 4-ethoxyphenol isocyanate |
| SMILES | CCOc1ccc(O)cc1.[N-]=C=O |
| InChI | InChI=1S/C8H10O2.CNO/c1-2-10-8-5-3-7(9)4-6-8;2-1-3/h3-6,9H,2H2,1H3;/q;-1 |
| InChIKey | HFEMMUTZFMKRBT-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 68.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.18 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 4-ethoxyphenol isocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxyphenol isocyanate?
The IUPAC name of 4-ethoxyphenol isocyanate (CID 20557311) is 4-ethoxyphenol isocyanate.
What is the SMILES notation for 4-ethoxyphenol isocyanate?
The canonical SMILES for 4-ethoxyphenol isocyanate is CCOc1ccc(O)cc1.[N-]=C=O.
What is the InChIKey of 4-ethoxyphenol isocyanate?
The InChIKey is HFEMMUTZFMKRBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2.CNO/c1-2-10-8-5-3-7(9)4-6-8;2-1-3/h3-6,9H,2H2,1H3;/q;-1.
What are the key properties of 4-ethoxyphenol isocyanate?
4-ethoxyphenol isocyanate has a molecular weight of 180.18 g/mol, XLogP of 1.68, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxyphenol isocyanate is sourced from PubChem (CID 20557311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).