C20H32N2 — CID 20559013
(5Z,9Z)-3,12-dicyclopentyl-1,2-diazacyclododeca-1,5,9-triene (PubChem CID 20559013) has the molecular formula C20H32N2 and a molecular weight of 300.49 g/mol. Its IUPAC name is (5Z,9Z)-3,12-dicyclopentyl-1,2-diazacyclododeca-1,5,9-triene.
| Compound Name | (5Z,9Z)-3,12-dicyclopentyl-1,2-diazacyclododeca-1,5,9-triene |
|---|---|
| PubChem CID | 20559013 |
| Molecular Formula | C20H32N2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.26 |
| IUPAC Name | (5Z,9Z)-3,12-dicyclopentyl-1,2-diazacyclododeca-1,5,9-triene |
| SMILES | C1=C\CC(C2CCCC2)/N=N/C(C2CCCC2)C/C=C\CC/1 |
| InChI | InChI=1S/C20H32N2/c1-2-4-6-16-20(18-13-9-10-14-18)22-21-19(15-5-3-1)17-11-7-8-12-17/h3-6,17-20H,1-2,7-16H2/b5-3-,6-4-,22-21+ |
| InChIKey | DCKRBYKJPRUSCG-AFEREHNSSA-N |
| XLogP | 6.24 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|