C17H29N3O4S — CID 20561651
N-[1-(diethylamino)ethyl]-5-(ethylsulfonylamino)-2-methoxy-3-methylbenzamide (PubChem CID 20561651) has the molecular formula C17H29N3O4S and a molecular weight of 371.50 g/mol. Its IUPAC name is N-[1-(diethylamino)ethyl]-5-(ethylsulfonylamino)-2-methoxy-3-methylbenzamide.
| Compound Name | N-[1-(diethylamino)ethyl]-5-(ethylsulfonylamino)-2-methoxy-3-methylbenzamide |
|---|---|
| PubChem CID | 20561651 |
| Molecular Formula | C17H29N3O4S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | N-[1-(diethylamino)ethyl]-5-(ethylsulfonylamino)-2-methoxy-3-methylbenzamide |
| SMILES | CCN(CC)C(C)NC(=O)c1cc(NS(=O)(=O)CC)cc(C)c1OC |
| InChI | InChI=1S/C17H29N3O4S/c1-7-20(8-2)13(5)18-17(21)15-11-14(19-25(22,23)9-3)10-12(4)16(15)24-6/h10-11,13,19H,7-9H2,1-6H3,(H,18,21) |
| InChIKey | LESVHXHVDXQNTC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|