C15H23BrClN3O5 — CID 88514289
5-bromo-N-[1-(diethylamino)ethyl]-2,3-dimethoxy-6-nitrobenzamide;hydrochloride (PubChem CID 88514289) has the molecular formula C15H23BrClN3O5 and a molecular weight of 440.72 g/mol. Its IUPAC name is 5-bromo-N-[1-(diethylamino)ethyl]-2,3-dimethoxy-6-nitrobenzamide;hydrochloride.
| Compound Name | 5-bromo-N-[1-(diethylamino)ethyl]-2,3-dimethoxy-6-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 88514289 |
| Molecular Formula | C15H23BrClN3O5 |
| Molecular Weight | 440.72 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | 5-bromo-N-[1-(diethylamino)ethyl]-2,3-dimethoxy-6-nitrobenzamide;hydrochloride |
| SMILES | CCN(CC)C(C)NC(=O)c1c(OC)c(OC)cc(Br)c1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C15H22BrN3O5.ClH/c1-6-18(7-2)9(3)17-15(20)12-13(19(21)22)10(16)8-11(23-4)14(12)24-5;/h8-9H,6-7H2,1-5H3,(H,17,20);1H |
| InChIKey | RNHNCHHKIVAGRW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.72 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|