C16H12N2O6 — CID 20563043
ethyl 2-methyl-8-nitro-10-oxochromeno[3,2-b]pyridine-3-carboxylate (PubChem CID 20563043) has the molecular formula C16H12N2O6 and a molecular weight of 328.28 g/mol. Its IUPAC name is ethyl 2-methyl-8-nitro-10-oxochromeno[3,2-b]pyridine-3-carboxylate.
| Compound Name | ethyl 2-methyl-8-nitro-10-oxochromeno[3,2-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 20563043 |
| Molecular Formula | C16H12N2O6 |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | ethyl 2-methyl-8-nitro-10-oxochromeno[3,2-b]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cc2oc3ccc([N+](=O)[O-])cc3c(=O)c2nc1C |
| InChI | InChI=1S/C16H12N2O6/c1-3-23-16(20)10-7-13-14(17-8(10)2)15(19)11-6-9(18(21)22)4-5-12(11)24-13/h4-7H,3H2,1-2H3 |
| InChIKey | GQXKKQPOSMOEJD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 112.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|