C10H7ClFN3O2 — CID 20565723
2-[3-(chloromethyl)-1,2,4-triazol-4-yl]-5-fluorobenzoic acid (PubChem CID 20565723) has the molecular formula C10H7ClFN3O2 and a molecular weight of 255.64 g/mol. Its IUPAC name is 2-[3-(chloromethyl)-1,2,4-triazol-4-yl]-5-fluorobenzoic acid.
| Compound Name | 2-[3-(chloromethyl)-1,2,4-triazol-4-yl]-5-fluorobenzoic acid |
|---|---|
| PubChem CID | 20565723 |
| Molecular Formula | C10H7ClFN3O2 |
| Molecular Weight | 255.64 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | 2-[3-(chloromethyl)-1,2,4-triazol-4-yl]-5-fluorobenzoic acid |
| SMILES | O=C(O)c1cc(F)ccc1-n1cnnc1CCl |
| InChI | InChI=1S/C10H7ClFN3O2/c11-4-9-14-13-5-15(9)8-2-1-6(12)3-7(8)10(16)17/h1-3,5H,4H2,(H,16,17) |
| InChIKey | XVEVVXHZQKDOEO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.64 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|