About hexanedioic acid;1-phenylpropan-2-amine
hexanedioic acid;1-phenylpropan-2-amine (PubChem CID 20567238) has the molecular formula C15H23NO4
and a molecular weight of 281.35 g/mol. Its IUPAC name is hexanedioic acid;1-phenylpropan-2-amine.
Molecular Properties
| Compound Name | hexanedioic acid;1-phenylpropan-2-amine |
| PubChem CID | 20567238 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | hexanedioic acid;1-phenylpropan-2-amine |
| SMILES | CC(N)Cc1ccccc1.O=C(O)CCCCC(=O)O |
| InChI | InChI=1S/C9H13N.C6H10O4/c1-8(10)7-9-5-3-2-4-6-9;7-5(8)3-1-2-4-6(9)10/h2-6,8H,7,10H2,1H3;1-4H2,(H,7,8)(H,9,10) |
| InChIKey | OFCJKOOVFDGTLY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexanedioic acid;1-phenylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexanedioic acid;1-phenylpropan-2-amine?
The IUPAC name of hexanedioic acid;1-phenylpropan-2-amine (CID 20567238) is hexanedioic acid;1-phenylpropan-2-amine.
What is the SMILES notation for hexanedioic acid;1-phenylpropan-2-amine?
The canonical SMILES for hexanedioic acid;1-phenylpropan-2-amine is CC(N)Cc1ccccc1.O=C(O)CCCCC(=O)O.
What is the InChIKey of hexanedioic acid;1-phenylpropan-2-amine?
The InChIKey is OFCJKOOVFDGTLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N.C6H10O4/c1-8(10)7-9-5-3-2-4-6-9;7-5(8)3-1-2-4-6(9)10/h2-6,8H,7,10H2,1H3;1-4H2,(H,7,8)(H,9,10).
What are the key properties of hexanedioic acid;1-phenylpropan-2-amine?
hexanedioic acid;1-phenylpropan-2-amine has a molecular weight of 281.35 g/mol, XLogP of 2.29, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexanedioic acid;1-phenylpropan-2-amine is sourced from PubChem (CID 20567238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).