C19H23N3O8 — CID 20569894
[1-(6,7-dimethoxyphthalazin-1-yl)piperidin-4-yl] acetate;oxalic acid (PubChem CID 20569894) has the molecular formula C19H23N3O8 and a molecular weight of 421.41 g/mol. Its IUPAC name is [1-(6,7-dimethoxyphthalazin-1-yl)piperidin-4-yl] acetate;oxalic acid.
| Compound Name | [1-(6,7-dimethoxyphthalazin-1-yl)piperidin-4-yl] acetate;oxalic acid |
|---|---|
| PubChem CID | 20569894 |
| Molecular Formula | C19H23N3O8 |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | [1-(6,7-dimethoxyphthalazin-1-yl)piperidin-4-yl] acetate;oxalic acid |
| SMILES | COc1cc2cnnc(N3CCC(OC(C)=O)CC3)c2cc1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H21N3O4.C2H2O4/c1-11(21)24-13-4-6-20(7-5-13)17-14-9-16(23-3)15(22-2)8-12(14)10-18-19-17;3-1(4)2(5)6/h8-10,13H,4-7H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | JTXVLIMJGLHFID-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 148.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|