C22H25N3O3 — CID 24877800
6,7-dimethoxy-1-[3-(4-methylphenoxy)piperidin-1-yl]phthalazine (PubChem CID 24877800) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is 6,7-dimethoxy-1-[3-(4-methylphenoxy)piperidin-1-yl]phthalazine.
| Compound Name | 6,7-dimethoxy-1-[3-(4-methylphenoxy)piperidin-1-yl]phthalazine |
|---|---|
| PubChem CID | 24877800 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 6,7-dimethoxy-1-[3-(4-methylphenoxy)piperidin-1-yl]phthalazine |
| SMILES | COc1cc2cnnc(N3CCCC(Oc4ccc(C)cc4)C3)c2cc1OC |
| InChI | InChI=1S/C22H25N3O3/c1-15-6-8-17(9-7-15)28-18-5-4-10-25(14-18)22-19-12-21(27-3)20(26-2)11-16(19)13-23-24-22/h6-9,11-13,18H,4-5,10,14H2,1-3H3 |
| InChIKey | WIJKSDZRJKZKNA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |