About 4-[3-(3,4-dimethoxyphenoxy)piperidin-1-yl]-2-methylsulfanyl-6-(trifluoromethyl)pyrimidine
4-[3-(3,4-dimethoxyphenoxy)piperidin-1-yl]-2-methylsulfanyl-6-(trifluoromethyl)pyrimidine (PubChem CID 134202074) has the molecular formula C19H22F3N3O3S
and a molecular weight of 429.46 g/mol. Its IUPAC name is 4-[3-(3,4-dimethoxyphenoxy)piperidin-1-yl]-2-methylsulfanyl-6-(trifluoromethyl)pyrimidine.
Molecular Properties
| Compound Name | 4-[3-(3,4-dimethoxyphenoxy)piperidin-1-yl]-2-methylsulfanyl-6-(trifluoromethyl)pyrimidine |
| PubChem CID | 134202074 |
| Molecular Formula | C19H22F3N3O3S |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 4-[3-(3,4-dimethoxyphenoxy)piperidin-1-yl]-2-methylsulfanyl-6-(trifluoromethyl)pyrimidine |
| SMILES | COc1ccc(OC2CCCN(c3cc(C(F)(F)F)nc(SC)n3)C2)cc1OC |
| InChI | InChI=1S/C19H22F3N3O3S/c1-26-14-7-6-12(9-15(14)27-2)28-13-5-4-8-25(11-13)17-10-16(19(20,21)22)23-18(24-17)29-3/h6-7,9-10,13H,4-5,8,11H2,1-3H3 |
| InChIKey | CJTZZHBQMBPKOW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[3-(3,4-dimethoxyphenoxy)piperidin-1-yl]-2-methylsulfanyl-6-(trifluoromethyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(3,4-dimethoxyphenoxy)piperidin-1-yl]-2-methylsulfanyl-6-(trifluoromethyl)pyrimidine?
The IUPAC name of 4-[3-(3,4-dimethoxyphenoxy)piperidin-1-yl]-2-methylsulfanyl-6-(trifluoromethyl)pyrimidine (CID 134202074) is 4-[3-(3,4-dimethoxyphenoxy)piperidin-1-yl]-2-methylsulfanyl-6-(trifluoromethyl)pyrimidine.
What is the SMILES notation for 4-[3-(3,4-dimethoxyphenoxy)piperidin-1-yl]-2-methylsulfanyl-6-(trifluoromethyl)pyrimidine?
The canonical SMILES for 4-[3-(3,4-dimethoxyphenoxy)piperidin-1-yl]-2-methylsulfanyl-6-(trifluoromethyl)pyrimidine is COc1ccc(OC2CCCN(c3cc(C(F)(F)F)nc(SC)n3)C2)cc1OC.
What is the InChIKey of 4-[3-(3,4-dimethoxyphenoxy)piperidin-1-yl]-2-methylsulfanyl-6-(trifluoromethyl)pyrimidine?
The InChIKey is CJTZZHBQMBPKOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22F3N3O3S/c1-26-14-7-6-12(9-15(14)27-2)28-13-5-4-8-25(11-13)17-10-16(19(20,21)22)23-18(24-17)29-3/h6-7,9-10,13H,4-5,8,11H2,1-3H3.
What are the key properties of 4-[3-(3,4-dimethoxyphenoxy)piperidin-1-yl]-2-methylsulfanyl-6-(trifluoromethyl)pyrimidine?
4-[3-(3,4-dimethoxyphenoxy)piperidin-1-yl]-2-methylsulfanyl-6-(trifluoromethyl)pyrimidine has a molecular weight of 429.46 g/mol, XLogP of 4.28, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(3,4-dimethoxyphenoxy)piperidin-1-yl]-2-methylsulfanyl-6-(trifluoromethyl)pyrimidine is sourced from PubChem (CID 134202074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).