About 1-[4-(2-cyclopropylpyrimidin-4-yl)piperidin-1-yl]-6,7-dimethoxyphthalazine
1-[4-(2-cyclopropylpyrimidin-4-yl)piperidin-1-yl]-6,7-dimethoxyphthalazine (PubChem CID 24876864) has the molecular formula C22H25N5O2
and a molecular weight of 391.48 g/mol. Its IUPAC name is 1-[4-(2-cyclopropylpyrimidin-4-yl)piperidin-1-yl]-6,7-dimethoxyphthalazine.
Molecular Properties
| Compound Name | 1-[4-(2-cyclopropylpyrimidin-4-yl)piperidin-1-yl]-6,7-dimethoxyphthalazine |
| PubChem CID | 24876864 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 1-[4-(2-cyclopropylpyrimidin-4-yl)piperidin-1-yl]-6,7-dimethoxyphthalazine |
| SMILES | COc1cc2cnnc(N3CCC(c4ccnc(C5CC5)n4)CC3)c2cc1OC |
| InChI | InChI=1S/C22H25N5O2/c1-28-19-11-16-13-24-26-22(17(16)12-20(19)29-2)27-9-6-14(7-10-27)18-5-8-23-21(25-18)15-3-4-15/h5,8,11-15H,3-4,6-7,9-10H2,1-2H3 |
| InChIKey | VXDNCJULNAVEGC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 73.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[4-(2-cyclopropylpyrimidin-4-yl)piperidin-1-yl]-6,7-dimethoxyphthalazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(2-cyclopropylpyrimidin-4-yl)piperidin-1-yl]-6,7-dimethoxyphthalazine?
The IUPAC name of 1-[4-(2-cyclopropylpyrimidin-4-yl)piperidin-1-yl]-6,7-dimethoxyphthalazine (CID 24876864) is 1-[4-(2-cyclopropylpyrimidin-4-yl)piperidin-1-yl]-6,7-dimethoxyphthalazine.
What is the SMILES notation for 1-[4-(2-cyclopropylpyrimidin-4-yl)piperidin-1-yl]-6,7-dimethoxyphthalazine?
The canonical SMILES for 1-[4-(2-cyclopropylpyrimidin-4-yl)piperidin-1-yl]-6,7-dimethoxyphthalazine is COc1cc2cnnc(N3CCC(c4ccnc(C5CC5)n4)CC3)c2cc1OC.
What is the InChIKey of 1-[4-(2-cyclopropylpyrimidin-4-yl)piperidin-1-yl]-6,7-dimethoxyphthalazine?
The InChIKey is VXDNCJULNAVEGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N5O2/c1-28-19-11-16-13-24-26-22(17(16)12-20(19)29-2)27-9-6-14(7-10-27)18-5-8-23-21(25-18)15-3-4-15/h5,8,11-15H,3-4,6-7,9-10H2,1-2H3.
What are the key properties of 1-[4-(2-cyclopropylpyrimidin-4-yl)piperidin-1-yl]-6,7-dimethoxyphthalazine?
1-[4-(2-cyclopropylpyrimidin-4-yl)piperidin-1-yl]-6,7-dimethoxyphthalazine has a molecular weight of 391.48 g/mol, XLogP of 3.70, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(2-cyclopropylpyrimidin-4-yl)piperidin-1-yl]-6,7-dimethoxyphthalazine is sourced from PubChem (CID 24876864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).