C22H21ClF3NO2 — CID 20571449
(Z)-5-(butan-2-ylamino)-4-(3-chlorophenyl)-1-[3-(trifluoromethyl)phenyl]pent-4-ene-1,3-dione (PubChem CID 20571449) has the molecular formula C22H21ClF3NO2 and a molecular weight of 423.86 g/mol. Its IUPAC name is (Z)-5-(butan-2-ylamino)-4-(3-chlorophenyl)-1-[3-(trifluoromethyl)phenyl]pent-4-ene-1,3-dione.
| Compound Name | (Z)-5-(butan-2-ylamino)-4-(3-chlorophenyl)-1-[3-(trifluoromethyl)phenyl]pent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 20571449 |
| Molecular Formula | C22H21ClF3NO2 |
| Molecular Weight | 423.86 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | (Z)-5-(butan-2-ylamino)-4-(3-chlorophenyl)-1-[3-(trifluoromethyl)phenyl]pent-4-ene-1,3-dione |
| SMILES | CCC(C)N/C=C(\C(=O)CC(=O)c1cccc(C(F)(F)F)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H21ClF3NO2/c1-3-14(2)27-13-19(15-6-5-9-18(23)11-15)21(29)12-20(28)16-7-4-8-17(10-16)22(24,25)26/h4-11,13-14,27H,3,12H2,1-2H3/b19-13- |
| InChIKey | UHLTZCXSFAVGLF-UYRXBGFRSA-N |
| XLogP | 5.93 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.86 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|