C18H20N4O4 — CID 20573943
ethyl N-(3-benzamido-6-diazo-4-methoxycyclohexa-1,3-dien-1-yl)-N-methylcarbamate (PubChem CID 20573943) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is ethyl N-(3-benzamido-6-diazo-4-methoxycyclohexa-1,3-dien-1-yl)-N-methylcarbamate.
| Compound Name | ethyl N-(3-benzamido-6-diazo-4-methoxycyclohexa-1,3-dien-1-yl)-N-methylcarbamate |
|---|---|
| PubChem CID | 20573943 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | ethyl N-(3-benzamido-6-diazo-4-methoxycyclohexa-1,3-dien-1-yl)-N-methylcarbamate |
| SMILES | CCOC(=O)N(C)C1=CC(NC(=O)c2ccccc2)=C(OC)CC1=[N+]=[N-] |
| InChI | InChI=1S/C18H20N4O4/c1-4-26-18(24)22(2)15-10-14(16(25-3)11-13(15)21-19)20-17(23)12-8-6-5-7-9-12/h5-10H,4,11H2,1-3H3,(H,20,23) |
| InChIKey | SXANUCLAZCOLPK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 104.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|