C14H12ClN3O2 — CID 154425223
N-(2-chloro-4-diazo-5-methoxycyclohexa-1,5-dien-1-yl)benzamide (PubChem CID 154425223) has the molecular formula C14H12ClN3O2 and a molecular weight of 289.72 g/mol. Its IUPAC name is N-(2-chloro-4-diazo-5-methoxycyclohexa-1,5-dien-1-yl)benzamide.
| Compound Name | N-(2-chloro-4-diazo-5-methoxycyclohexa-1,5-dien-1-yl)benzamide |
|---|---|
| PubChem CID | 154425223 |
| Molecular Formula | C14H12ClN3O2 |
| Molecular Weight | 289.72 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | N-(2-chloro-4-diazo-5-methoxycyclohexa-1,5-dien-1-yl)benzamide |
| SMILES | COC1=CC(NC(=O)c2ccccc2)=C(Cl)CC1=[N+]=[N-] |
| InChI | InChI=1S/C14H12ClN3O2/c1-20-13-8-11(10(15)7-12(13)18-16)17-14(19)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,17,19) |
| InChIKey | DSDKZZYDFANVIJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.72 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|