C21H40N4O — CID 20574166
1,3-bis(2,2,6,6-tetramethylpiperidin-4-yl)imidazolidin-2-one (PubChem CID 20574166) has the molecular formula C21H40N4O and a molecular weight of 364.58 g/mol. Its IUPAC name is 1,3-bis(2,2,6,6-tetramethylpiperidin-4-yl)imidazolidin-2-one.
| Compound Name | 1,3-bis(2,2,6,6-tetramethylpiperidin-4-yl)imidazolidin-2-one |
|---|---|
| PubChem CID | 20574166 |
| Molecular Formula | C21H40N4O |
| Molecular Weight | 364.58 g/mol |
| Exact Mass | 364.32 |
| IUPAC Name | 1,3-bis(2,2,6,6-tetramethylpiperidin-4-yl)imidazolidin-2-one |
| SMILES | CC1(C)CC(N2CCN(C3CC(C)(C)NC(C)(C)C3)C2=O)CC(C)(C)N1 |
| InChI | InChI=1S/C21H40N4O/c1-18(2)11-15(12-19(3,4)22-18)24-9-10-25(17(24)26)16-13-20(5,6)23-21(7,8)14-16/h15-16,22-23H,9-14H2,1-8H3 |
| InChIKey | FMVQXSCBNLRPKZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.58 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |