C23H29F5O4 — CID 20576312
2-[4-[(4-ethoxy-2,3-difluorophenyl)-difluoromethoxy]cyclohexyl]-5-[(E)-4-fluorobut-1-enyl]-1,3-dioxane (PubChem CID 20576312) has the molecular formula C23H29F5O4 and a molecular weight of 464.47 g/mol. Its IUPAC name is 2-[4-[(4-ethoxy-2,3-difluorophenyl)-difluoromethoxy]cyclohexyl]-5-[(E)-4-fluorobut-1-enyl]-1,3-dioxane.
| Compound Name | 2-[4-[(4-ethoxy-2,3-difluorophenyl)-difluoromethoxy]cyclohexyl]-5-[(E)-4-fluorobut-1-enyl]-1,3-dioxane |
|---|---|
| PubChem CID | 20576312 |
| Molecular Formula | C23H29F5O4 |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 2-[4-[(4-ethoxy-2,3-difluorophenyl)-difluoromethoxy]cyclohexyl]-5-[(E)-4-fluorobut-1-enyl]-1,3-dioxane |
| SMILES | CCOc1ccc(C(F)(F)OC2CCC(C3OCC(/C=C/CCF)CO3)CC2)c(F)c1F |
| InChI | InChI=1S/C23H29F5O4/c1-2-29-19-11-10-18(20(25)21(19)26)23(27,28)32-17-8-6-16(7-9-17)22-30-13-15(14-31-22)5-3-4-12-24/h3,5,10-11,15-17,22H,2,4,6-9,12-14H2,1H3/b5-3+ |
| InChIKey | HAMLQEHNIFBTLP-HWKANZROSA-N |
| XLogP | 5.89 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|