C16H18N3NaO3 — CID 20576634
sodium (E)-[1-(4-ethylphenyl)-3-morpholin-4-yl-5-oxopyrazol-4-ylidene]methanolate (PubChem CID 20576634) has the molecular formula C16H18N3NaO3 and a molecular weight of 323.33 g/mol. Its IUPAC name is sodium (E)-[1-(4-ethylphenyl)-3-morpholin-4-yl-5-oxopyrazol-4-ylidene]methanolate.
| Compound Name | sodium (E)-[1-(4-ethylphenyl)-3-morpholin-4-yl-5-oxopyrazol-4-ylidene]methanolate |
|---|---|
| PubChem CID | 20576634 |
| Molecular Formula | C16H18N3NaO3 |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | sodium (E)-[1-(4-ethylphenyl)-3-morpholin-4-yl-5-oxopyrazol-4-ylidene]methanolate |
| SMILES | CCc1ccc(N2N=C(N3CCOCC3)/C(=C\[O-])C2=O)cc1.[Na+] |
| InChI | InChI=1S/C16H19N3O3.Na/c1-2-12-3-5-13(6-4-12)19-16(21)14(11-20)15(17-19)18-7-9-22-10-8-18;/h3-6,11,20H,2,7-10H2,1H3;/q;+1/p-1/b14-11+; |
| InChIKey | YBILFVMKDATDKF-JHGYPSGKSA-M |
| XLogP | -2.51 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|