C10H19O4PW — CID 20576710
carbanide;3-methoxy-5-methyl-4-methylphosphanyloxy-3,4,5,6-tetrahydro-2H-pyran-6-ide-2-carbaldehyde;tungsten(2+) (PubChem CID 20576710) has the molecular formula C10H19O4PW and a molecular weight of 418.07 g/mol. Its IUPAC name is carbanide;3-methoxy-5-methyl-4-methylphosphanyloxy-3,4,5,6-tetrahydro-2H-pyran-6-ide-2-carbaldehyde;tungsten(2+).
| Compound Name | carbanide;3-methoxy-5-methyl-4-methylphosphanyloxy-3,4,5,6-tetrahydro-2H-pyran-6-ide-2-carbaldehyde;tungsten(2+) |
|---|---|
| PubChem CID | 20576710 |
| Molecular Formula | C10H19O4PW |
| Molecular Weight | 418.07 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | carbanide;3-methoxy-5-methyl-4-methylphosphanyloxy-3,4,5,6-tetrahydro-2H-pyran-6-ide-2-carbaldehyde;tungsten(2+) |
| SMILES | COC1C(C=O)O[CH-]C(C)C1OPC.[CH3-].[W+2] |
| InChI | InChI=1S/C9H16O4P.CH3.W/c1-6-5-12-7(4-10)9(11-2)8(6)13-14-3;;/h4-9,14H,1-3H3;1H3;/q2*-1;+2 |
| InChIKey | PXHIEZJZJOKWKY-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.07 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|