C10H18O4 — CID 20662025
3,4-dimethoxy-5,6-dimethyloxane-2-carbaldehyde (PubChem CID 20662025) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is 3,4-dimethoxy-5,6-dimethyloxane-2-carbaldehyde.
| Compound Name | 3,4-dimethoxy-5,6-dimethyloxane-2-carbaldehyde |
|---|---|
| PubChem CID | 20662025 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 3,4-dimethoxy-5,6-dimethyloxane-2-carbaldehyde |
| SMILES | COC1C(C=O)OC(C)C(C)C1OC |
| InChI | InChI=1S/C10H18O4/c1-6-7(2)14-8(5-11)10(13-4)9(6)12-3/h5-10H,1-4H3 |
| InChIKey | AIHHWNGJZMVKQC-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|