C9H16O4 — CID 59085458
(2R,5S)-4-hydroxy-6-(hydroxymethyl)-3,5-dimethyloxane-2-carbaldehyde (PubChem CID 59085458) has the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. Its IUPAC name is (2R,5S)-4-hydroxy-6-(hydroxymethyl)-3,5-dimethyloxane-2-carbaldehyde.
| Compound Name | (2R,5S)-4-hydroxy-6-(hydroxymethyl)-3,5-dimethyloxane-2-carbaldehyde |
|---|---|
| PubChem CID | 59085458 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | (2R,5S)-4-hydroxy-6-(hydroxymethyl)-3,5-dimethyloxane-2-carbaldehyde |
| SMILES | CC1C(O)[C@H](C)C(CO)O[C@H]1C=O |
| InChI | InChI=1S/C9H16O4/c1-5-7(3-10)13-8(4-11)6(2)9(5)12/h3,5-9,11-12H,4H2,1-2H3/t5?,6-,7+,8?,9?/m1/s1 |
| InChIKey | LQSCRNHQTKOFHT-MGPOHBFLSA-N |
| XLogP | -0.42 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|