C10H18O3 — CID 20768709
3-methoxy-4,5,6-trimethyloxane-2-carbaldehyde (PubChem CID 20768709) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is 3-methoxy-4,5,6-trimethyloxane-2-carbaldehyde.
| Compound Name | 3-methoxy-4,5,6-trimethyloxane-2-carbaldehyde |
|---|---|
| PubChem CID | 20768709 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 3-methoxy-4,5,6-trimethyloxane-2-carbaldehyde |
| SMILES | COC1C(C=O)OC(C)C(C)C1C |
| InChI | InChI=1S/C10H18O3/c1-6-7(2)10(12-4)9(5-11)13-8(6)3/h5-10H,1-4H3 |
| InChIKey | IJXRSQZNZWLTDQ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|