C16H21NO2 — CID 20577153
1,5-ditert-butylindole-2,3-dione (PubChem CID 20577153) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is 1,5-ditert-butylindole-2,3-dione.
| Compound Name | 1,5-ditert-butylindole-2,3-dione |
|---|---|
| PubChem CID | 20577153 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 1,5-ditert-butylindole-2,3-dione |
| SMILES | CC(C)(C)c1ccc2c(c1)C(=O)C(=O)N2C(C)(C)C |
| InChI | InChI=1S/C16H21NO2/c1-15(2,3)10-7-8-12-11(9-10)13(18)14(19)17(12)16(4,5)6/h7-9H,1-6H3 |
| InChIKey | LHRHZFFSXUPSRS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|