C25H35N — CID 143619997
2,7,10-tritert-butyl-9H-acridine (PubChem CID 143619997) has the molecular formula C25H35N and a molecular weight of 349.56 g/mol. Its IUPAC name is 2,7,10-tritert-butyl-9H-acridine.
| Compound Name | 2,7,10-tritert-butyl-9H-acridine |
|---|---|
| PubChem CID | 143619997 |
| Molecular Formula | C25H35N |
| Molecular Weight | 349.56 g/mol |
| Exact Mass | 349.28 |
| IUPAC Name | 2,7,10-tritert-butyl-9H-acridine |
| SMILES | CC(C)(C)c1ccc2c(c1)Cc1cc(C(C)(C)C)ccc1N2C(C)(C)C |
| InChI | InChI=1S/C25H35N/c1-23(2,3)19-10-12-21-17(15-19)14-18-16-20(24(4,5)6)11-13-22(18)26(21)25(7,8)9/h10-13,15-16H,14H2,1-9H3 |
| InChIKey | HTOXWIYYDFGUJO-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.56 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |