C16H24O3 — CID 20579761
5-[2-[(E)-7-hydroxyoct-3-en-5-ynyl]cyclopropyl]pentanoic acid (PubChem CID 20579761) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is 5-[2-[(E)-7-hydroxyoct-3-en-5-ynyl]cyclopropyl]pentanoic acid.
| Compound Name | 5-[2-[(E)-7-hydroxyoct-3-en-5-ynyl]cyclopropyl]pentanoic acid |
|---|---|
| PubChem CID | 20579761 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 5-[2-[(E)-7-hydroxyoct-3-en-5-ynyl]cyclopropyl]pentanoic acid |
| SMILES | CC(O)C#C/C=C/CCC1CC1CCCCC(=O)O |
| InChI | InChI=1S/C16H24O3/c1-13(17)8-4-2-3-5-9-14-12-15(14)10-6-7-11-16(18)19/h2-3,13-15,17H,5-7,9-12H2,1H3,(H,18,19)/b3-2+ |
| InChIKey | DQMSZAYMZBFLJC-NSCUHMNNSA-N |
| XLogP | 2.99 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|