About CID 20579942
CID 20579942 (PubChem CID 20579942) has the molecular formula C34H41BO11
and a molecular weight of 636.50 g/mol.
Molecular Properties
| Compound Name | CID 20579942 |
| PubChem CID | 20579942 |
| Molecular Formula | C34H41BO11 |
| Molecular Weight | 636.50 g/mol |
| Exact Mass | 636.27 |
| IUPAC Name | — |
| SMILES | [B]C1(C)C=Cc2c(C(=O)OC)c(-c3ccc(COCC(CO)(CO)CO)cc3)c3ccc(COCC(CO)(CO)CO)cc3c2O1 |
| InChI | InChI=1S/C34H41BO11/c1-32(35)10-9-26-29(31(42)43-2)28(24-6-3-22(4-7-24)12-44-20-33(14-36,15-37)16-38)25-8-5-23(11-27(25)30(26)46-32)13-45-21-34(17-39,18-40)19-41/h3-11,36-41H,12-21H2,1-2H3 |
| InChIKey | NSUZMAAQRFMGTN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 175.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 636.50 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 20579942 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 20579942?
The IUPAC name of CID 20579942 (CID 20579942) is not available.
What is the SMILES notation for CID 20579942?
The canonical SMILES for CID 20579942 is [B]C1(C)C=Cc2c(C(=O)OC)c(-c3ccc(COCC(CO)(CO)CO)cc3)c3ccc(COCC(CO)(CO)CO)cc3c2O1.
What is the InChIKey of CID 20579942?
The InChIKey is NSUZMAAQRFMGTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H41BO11/c1-32(35)10-9-26-29(31(42)43-2)28(24-6-3-22(4-7-24)12-44-20-33(14-36,15-37)16-38)25-8-5-23(11-27(25)30(26)46-32)13-45-21-34(17-39,18-40)19-41/h3-11,36-41H,12-21H2,1-2H3.
What are the key properties of CID 20579942?
CID 20579942 has a molecular weight of 636.50 g/mol, XLogP of 1.54, 16 rotatable bonds, 6 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for CID 20579942 is sourced from PubChem (CID 20579942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).