C34H41BO11 — CID 20579942
CID 20579942 (PubChem CID 20579942) has the molecular formula C34H41BO11 and a molecular weight of 636.50 g/mol.
| Compound Name | CID 20579942 |
|---|---|
| PubChem CID | 20579942 |
| Molecular Formula | C34H41BO11 |
| Molecular Weight | 636.50 g/mol |
| Exact Mass | 636.27 |
| IUPAC Name | — |
| SMILES | [B]C1(C)C=Cc2c(C(=O)OC)c(-c3ccc(COCC(CO)(CO)CO)cc3)c3ccc(COCC(CO)(CO)CO)cc3c2O1 |
| InChI | InChI=1S/C34H41BO11/c1-32(35)10-9-26-29(31(42)43-2)28(24-6-3-22(4-7-24)12-44-20-33(14-36,15-37)16-38)25-8-5-23(11-27(25)30(26)46-32)13-45-21-34(17-39,18-40)19-41/h3-11,36-41H,12-21H2,1-2H3 |
| InChIKey | NSUZMAAQRFMGTN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 175.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.50 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|