C12H16NO4P — CID 20580605
2-(2-hydroxyethyl)-2-(2-phosphanyloxyethyl)-4H-1,4-benzoxazin-3-one (PubChem CID 20580605) has the molecular formula C12H16NO4P and a molecular weight of 269.24 g/mol. Its IUPAC name is 2-(2-hydroxyethyl)-2-(2-phosphanyloxyethyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 2-(2-hydroxyethyl)-2-(2-phosphanyloxyethyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 20580605 |
| Molecular Formula | C12H16NO4P |
| Molecular Weight | 269.24 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 2-(2-hydroxyethyl)-2-(2-phosphanyloxyethyl)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1Nc2ccccc2OC1(CCO)CCOP |
| InChI | InChI=1S/C12H16NO4P/c14-7-5-12(6-8-16-18)11(15)13-9-3-1-2-4-10(9)17-12/h1-4,14H,5-8,18H2,(H,13,15) |
| InChIKey | JKJCGLHUSOZHFQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.24 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|