C27H38N4O3 — CID 20583310
2-(4-amino-2,3,5-trimethylphenoxy)-2-methyl-N-[1-[2-(2-methylanilino)-2-oxoethyl]piperidin-4-yl]propanamide (PubChem CID 20583310) has the molecular formula C27H38N4O3 and a molecular weight of 466.63 g/mol. Its IUPAC name is 2-(4-amino-2,3,5-trimethylphenoxy)-2-methyl-N-[1-[2-(2-methylanilino)-2-oxoethyl]piperidin-4-yl]propanamide.
| Compound Name | 2-(4-amino-2,3,5-trimethylphenoxy)-2-methyl-N-[1-[2-(2-methylanilino)-2-oxoethyl]piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 20583310 |
| Molecular Formula | C27H38N4O3 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | 2-(4-amino-2,3,5-trimethylphenoxy)-2-methyl-N-[1-[2-(2-methylanilino)-2-oxoethyl]piperidin-4-yl]propanamide |
| SMILES | Cc1ccccc1NC(=O)CN1CCC(NC(=O)C(C)(C)Oc2cc(C)c(N)c(C)c2C)CC1 |
| InChI | InChI=1S/C27H38N4O3/c1-17-9-7-8-10-22(17)30-24(32)16-31-13-11-21(12-14-31)29-26(33)27(5,6)34-23-15-18(2)25(28)20(4)19(23)3/h7-10,15,21H,11-14,16,28H2,1-6H3,(H,29,33)(H,30,32) |
| InChIKey | WVGMSEVIGKIERC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|