C27H39N3O2 — CID 91038471
2-(4-amino-2,3,5-trimethylphenoxy)-2-methyl-N-[1-(2-phenylethyl)piperidin-4-yl]butanamide (PubChem CID 91038471) has the molecular formula C27H39N3O2 and a molecular weight of 437.63 g/mol. Its IUPAC name is 2-(4-amino-2,3,5-trimethylphenoxy)-2-methyl-N-[1-(2-phenylethyl)piperidin-4-yl]butanamide.
| Compound Name | 2-(4-amino-2,3,5-trimethylphenoxy)-2-methyl-N-[1-(2-phenylethyl)piperidin-4-yl]butanamide |
|---|---|
| PubChem CID | 91038471 |
| Molecular Formula | C27H39N3O2 |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.30 |
| IUPAC Name | 2-(4-amino-2,3,5-trimethylphenoxy)-2-methyl-N-[1-(2-phenylethyl)piperidin-4-yl]butanamide |
| SMILES | CCC(C)(Oc1cc(C)c(N)c(C)c1C)C(=O)NC1CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C27H39N3O2/c1-6-27(5,32-24-18-19(2)25(28)21(4)20(24)3)26(31)29-23-13-16-30(17-14-23)15-12-22-10-8-7-9-11-22/h7-11,18,23H,6,12-17,28H2,1-5H3,(H,29,31) |
| InChIKey | WSYRCXYIIOTKSV-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|