C28H39N3O2 — CID 91258052
2-(4-amino-2,3,5-trimethylphenoxy)-N-[1-[(2-phenylcyclopropyl)methyl]piperidin-4-yl]butanamide (PubChem CID 91258052) has the molecular formula C28H39N3O2 and a molecular weight of 449.64 g/mol. Its IUPAC name is 2-(4-amino-2,3,5-trimethylphenoxy)-N-[1-[(2-phenylcyclopropyl)methyl]piperidin-4-yl]butanamide.
| Compound Name | 2-(4-amino-2,3,5-trimethylphenoxy)-N-[1-[(2-phenylcyclopropyl)methyl]piperidin-4-yl]butanamide |
|---|---|
| PubChem CID | 91258052 |
| Molecular Formula | C28H39N3O2 |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.30 |
| IUPAC Name | 2-(4-amino-2,3,5-trimethylphenoxy)-N-[1-[(2-phenylcyclopropyl)methyl]piperidin-4-yl]butanamide |
| SMILES | CCC(Oc1cc(C)c(N)c(C)c1C)C(=O)NC1CCN(CC2CC2c2ccccc2)CC1 |
| InChI | InChI=1S/C28H39N3O2/c1-5-25(33-26-15-18(2)27(29)20(4)19(26)3)28(32)30-23-11-13-31(14-12-23)17-22-16-24(22)21-9-7-6-8-10-21/h6-10,15,22-25H,5,11-14,16-17,29H2,1-4H3,(H,30,32) |
| InChIKey | ZALPITXZZULFQP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|