C27H40N4O3 — CID 91548392
2-(4-amino-2,3,5-trimethylphenoxy)-N-[1-(2-anilino-2-hydroxyethyl)piperidin-4-yl]pentanamide (PubChem CID 91548392) has the molecular formula C27H40N4O3 and a molecular weight of 468.64 g/mol. Its IUPAC name is 2-(4-amino-2,3,5-trimethylphenoxy)-N-[1-(2-anilino-2-hydroxyethyl)piperidin-4-yl]pentanamide.
| Compound Name | 2-(4-amino-2,3,5-trimethylphenoxy)-N-[1-(2-anilino-2-hydroxyethyl)piperidin-4-yl]pentanamide |
|---|---|
| PubChem CID | 91548392 |
| Molecular Formula | C27H40N4O3 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.31 |
| IUPAC Name | 2-(4-amino-2,3,5-trimethylphenoxy)-N-[1-(2-anilino-2-hydroxyethyl)piperidin-4-yl]pentanamide |
| SMILES | CCCC(Oc1cc(C)c(N)c(C)c1C)C(=O)NC1CCN(CC(O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C27H40N4O3/c1-5-9-23(34-24-16-18(2)26(28)20(4)19(24)3)27(33)30-22-12-14-31(15-13-22)17-25(32)29-21-10-7-6-8-11-21/h6-8,10-11,16,22-23,25,29,32H,5,9,12-15,17,28H2,1-4H3,(H,30,33) |
| InChIKey | NPAWJYTYULRMDC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|