C25H35N3O3 — CID 87636291
2-(4-amino-2,3,5-trimethylphenoxy)-N-[1-(2-hydroxy-2-phenylethyl)piperidin-4-yl]-N-methylacetamide (PubChem CID 87636291) has the molecular formula C25H35N3O3 and a molecular weight of 425.57 g/mol. Its IUPAC name is 2-(4-amino-2,3,5-trimethylphenoxy)-N-[1-(2-hydroxy-2-phenylethyl)piperidin-4-yl]-N-methylacetamide.
| Compound Name | 2-(4-amino-2,3,5-trimethylphenoxy)-N-[1-(2-hydroxy-2-phenylethyl)piperidin-4-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 87636291 |
| Molecular Formula | C25H35N3O3 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | 2-(4-amino-2,3,5-trimethylphenoxy)-N-[1-(2-hydroxy-2-phenylethyl)piperidin-4-yl]-N-methylacetamide |
| SMILES | Cc1cc(OCC(=O)N(C)C2CCN(CC(O)c3ccccc3)CC2)c(C)c(C)c1N |
| InChI | InChI=1S/C25H35N3O3/c1-17-14-23(18(2)19(3)25(17)26)31-16-24(30)27(4)21-10-12-28(13-11-21)15-22(29)20-8-6-5-7-9-20/h5-9,14,21-22,29H,10-13,15-16,26H2,1-4H3 |
| InChIKey | PMPHELRMFHYNOX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|