C28H39ClN4O3 — CID 87635087
2-(4-amino-2-chloro-3,5,6-trimethylphenoxy)-N-[1-[2-hydroxy-2-[(1-phenylcyclopropyl)amino]ethyl]piperidin-4-yl]-N-methylacetamide (PubChem CID 87635087) has the molecular formula C28H39ClN4O3 and a molecular weight of 515.10 g/mol. Its IUPAC name is 2-(4-amino-2-chloro-3,5,6-trimethylphenoxy)-N-[1-[2-hydroxy-2-[(1-phenylcyclopropyl)amino]ethyl]piperidin-4-yl]-N-methylacetamide.
| Compound Name | 2-(4-amino-2-chloro-3,5,6-trimethylphenoxy)-N-[1-[2-hydroxy-2-[(1-phenylcyclopropyl)amino]ethyl]piperidin-4-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 87635087 |
| Molecular Formula | C28H39ClN4O3 |
| Molecular Weight | 515.10 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | 2-(4-amino-2-chloro-3,5,6-trimethylphenoxy)-N-[1-[2-hydroxy-2-[(1-phenylcyclopropyl)amino]ethyl]piperidin-4-yl]-N-methylacetamide |
| SMILES | Cc1c(C)c(OCC(=O)N(C)C2CCN(CC(O)NC3(c4ccccc4)CC3)CC2)c(Cl)c(C)c1N |
| InChI | InChI=1S/C28H39ClN4O3/c1-18-19(2)27(25(29)20(3)26(18)30)36-17-24(35)32(4)22-10-14-33(15-11-22)16-23(34)31-28(12-13-28)21-8-6-5-7-9-21/h5-9,22-23,31,34H,10-17,30H2,1-4H3 |
| InChIKey | ODDQBXWGXZBUOC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.10 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|