C25H33ClN4O3 — CID 20583340
2-[4-[[2-(4-amino-2-chloro-3,5,6-trimethylphenoxy)acetyl]-methylamino]piperidin-1-yl]-N-phenylacetamide (PubChem CID 20583340) has the molecular formula C25H33ClN4O3 and a molecular weight of 473.02 g/mol. Its IUPAC name is 2-[4-[[2-(4-amino-2-chloro-3,5,6-trimethylphenoxy)acetyl]-methylamino]piperidin-1-yl]-N-phenylacetamide.
| Compound Name | 2-[4-[[2-(4-amino-2-chloro-3,5,6-trimethylphenoxy)acetyl]-methylamino]piperidin-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 20583340 |
| Molecular Formula | C25H33ClN4O3 |
| Molecular Weight | 473.02 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 2-[4-[[2-(4-amino-2-chloro-3,5,6-trimethylphenoxy)acetyl]-methylamino]piperidin-1-yl]-N-phenylacetamide |
| SMILES | Cc1c(C)c(OCC(=O)N(C)C2CCN(CC(=O)Nc3ccccc3)CC2)c(Cl)c(C)c1N |
| InChI | InChI=1S/C25H33ClN4O3/c1-16-17(2)25(23(26)18(3)24(16)27)33-15-22(32)29(4)20-10-12-30(13-11-20)14-21(31)28-19-8-6-5-7-9-19/h5-9,20H,10-15,27H2,1-4H3,(H,28,31) |
| InChIKey | UBARQNTZFDHPGQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.02 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|