C25H33N3O3 — CID 10202552
2-(4-amino-2,3,5,6-tetramethylphenoxy)-N-(1-benzoylpiperidin-4-yl)-N-methylacetamide (PubChem CID 10202552) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is 2-(4-amino-2,3,5,6-tetramethylphenoxy)-N-(1-benzoylpiperidin-4-yl)-N-methylacetamide.
| Compound Name | 2-(4-amino-2,3,5,6-tetramethylphenoxy)-N-(1-benzoylpiperidin-4-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 10202552 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | 2-(4-amino-2,3,5,6-tetramethylphenoxy)-N-(1-benzoylpiperidin-4-yl)-N-methylacetamide |
| SMILES | Cc1c(C)c(OCC(=O)N(C)C2CCN(C(=O)c3ccccc3)CC2)c(C)c(C)c1N |
| InChI | InChI=1S/C25H33N3O3/c1-16-18(3)24(19(4)17(2)23(16)26)31-15-22(29)27(5)21-11-13-28(14-12-21)25(30)20-9-7-6-8-10-20/h6-10,21H,11-15,26H2,1-5H3 |
| InChIKey | UQGCIEYGWAFZHZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|