C25H35N3O2 — CID 87635074
2-(4-amino-2,3,6-trimethylphenoxy)-N-[1-(2-ethylphenyl)piperidin-4-yl]-N-methylacetamide (PubChem CID 87635074) has the molecular formula C25H35N3O2 and a molecular weight of 409.57 g/mol. Its IUPAC name is 2-(4-amino-2,3,6-trimethylphenoxy)-N-[1-(2-ethylphenyl)piperidin-4-yl]-N-methylacetamide.
| Compound Name | 2-(4-amino-2,3,6-trimethylphenoxy)-N-[1-(2-ethylphenyl)piperidin-4-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 87635074 |
| Molecular Formula | C25H35N3O2 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | 2-(4-amino-2,3,6-trimethylphenoxy)-N-[1-(2-ethylphenyl)piperidin-4-yl]-N-methylacetamide |
| SMILES | CCc1ccccc1N1CCC(N(C)C(=O)COc2c(C)cc(N)c(C)c2C)CC1 |
| InChI | InChI=1S/C25H35N3O2/c1-6-20-9-7-8-10-23(20)28-13-11-21(12-14-28)27(5)24(29)16-30-25-17(2)15-22(26)18(3)19(25)4/h7-10,15,21H,6,11-14,16,26H2,1-5H3 |
| InChIKey | IJXBCHCPYWJEQZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|