C27H37N3O2 — CID 163512958
2-(4-amino-2,3,5-trimethylphenoxy)-N-[1-(3-phenylcyclobutyl)piperidin-4-yl]propanamide (PubChem CID 163512958) has the molecular formula C27H37N3O2 and a molecular weight of 435.61 g/mol. Its IUPAC name is 2-(4-amino-2,3,5-trimethylphenoxy)-N-[1-(3-phenylcyclobutyl)piperidin-4-yl]propanamide.
| Compound Name | 2-(4-amino-2,3,5-trimethylphenoxy)-N-[1-(3-phenylcyclobutyl)piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 163512958 |
| Molecular Formula | C27H37N3O2 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.29 |
| IUPAC Name | 2-(4-amino-2,3,5-trimethylphenoxy)-N-[1-(3-phenylcyclobutyl)piperidin-4-yl]propanamide |
| SMILES | Cc1cc(OC(C)C(=O)NC2CCN(C3CC(c4ccccc4)C3)CC2)c(C)c(C)c1N |
| InChI | InChI=1S/C27H37N3O2/c1-17-14-25(18(2)19(3)26(17)28)32-20(4)27(31)29-23-10-12-30(13-11-23)24-15-22(16-24)21-8-6-5-7-9-21/h5-9,14,20,22-24H,10-13,15-16,28H2,1-4H3,(H,29,31) |
| InChIKey | DEGDVRVMGQBNTM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|