C6H13O2Si — CID 20583938
CID 20583938 (PubChem CID 20583938) has the molecular formula C6H13O2Si and a molecular weight of 145.25 g/mol.
| Compound Name | CID 20583938 |
|---|---|
| PubChem CID | 20583938 |
| Molecular Formula | C6H13O2Si |
| Molecular Weight | 145.25 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | — |
| SMILES | C[Si](C)COCC1CO1 |
| InChI | InChI=1S/C6H13O2Si/c1-9(2)5-7-3-6-4-8-6/h6H,3-5H2,1-2H3 |
| InChIKey | XUXYRWMBISEJBC-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.25 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|