C19H18N4O2 — CID 20585779
2-[5-isocyano-2-(phenoxymethyl)benzimidazol-1-yl]-N,N-dimethylacetamide (PubChem CID 20585779) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is 2-[5-isocyano-2-(phenoxymethyl)benzimidazol-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[5-isocyano-2-(phenoxymethyl)benzimidazol-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 20585779 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 2-[5-isocyano-2-(phenoxymethyl)benzimidazol-1-yl]-N,N-dimethylacetamide |
| SMILES | [C-]#[N+]c1ccc2c(c1)nc(COc1ccccc1)n2CC(=O)N(C)C |
| InChI | InChI=1S/C19H18N4O2/c1-20-14-9-10-17-16(11-14)21-18(23(17)12-19(24)22(2)3)13-25-15-7-5-4-6-8-15/h4-11H,12-13H2,2-3H3 |
| InChIKey | FYNZHCAMGWGPBH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 51.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|