C11H15BN2O3W — CID 20588413
7-amino-2-[hydroxy(methyl)boranyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid;tungsten (PubChem CID 20588413) has the molecular formula C11H15BN2O3W and a molecular weight of 417.90 g/mol. Its IUPAC name is 7-amino-2-[hydroxy(methyl)boranyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid;tungsten.
| Compound Name | 7-amino-2-[hydroxy(methyl)boranyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid;tungsten |
|---|---|
| PubChem CID | 20588413 |
| Molecular Formula | C11H15BN2O3W |
| Molecular Weight | 417.90 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | 7-amino-2-[hydroxy(methyl)boranyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid;tungsten |
| SMILES | CB(O)N1Cc2cc(N)ccc2CC1C(=O)O.[W] |
| InChI | InChI=1S/C11H15BN2O3.W/c1-12(17)14-6-8-4-9(13)3-2-7(8)5-10(14)11(15)16;/h2-4,10,17H,5-6,13H2,1H3,(H,15,16); |
| InChIKey | QROCUVIMLDTAHM-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.90 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|