C28H20F3N3O6 — CID 20588762
2-methyl-N-[3-[(2-methyl-1,3-dioxoisoindol-5-yl)oxymethylamino]-5-(trifluoromethyl)phenyl]-1,3-dioxoindene-5-carboxamide (PubChem CID 20588762) has the molecular formula C28H20F3N3O6 and a molecular weight of 551.48 g/mol. Its IUPAC name is 2-methyl-N-[3-[(2-methyl-1,3-dioxoisoindol-5-yl)oxymethylamino]-5-(trifluoromethyl)phenyl]-1,3-dioxoindene-5-carboxamide.
| Compound Name | 2-methyl-N-[3-[(2-methyl-1,3-dioxoisoindol-5-yl)oxymethylamino]-5-(trifluoromethyl)phenyl]-1,3-dioxoindene-5-carboxamide |
|---|---|
| PubChem CID | 20588762 |
| Molecular Formula | C28H20F3N3O6 |
| Molecular Weight | 551.48 g/mol |
| Exact Mass | 551.13 |
| IUPAC Name | 2-methyl-N-[3-[(2-methyl-1,3-dioxoisoindol-5-yl)oxymethylamino]-5-(trifluoromethyl)phenyl]-1,3-dioxoindene-5-carboxamide |
| SMILES | CC1C(=O)c2ccc(C(=O)Nc3cc(NCOc4ccc5c(c4)C(=O)N(C)C5=O)cc(C(F)(F)F)c3)cc2C1=O |
| InChI | InChI=1S/C28H20F3N3O6/c1-13-23(35)19-5-3-14(7-21(19)24(13)36)25(37)33-17-9-15(28(29,30)31)8-16(10-17)32-12-40-18-4-6-20-22(11-18)27(39)34(2)26(20)38/h3-11,13,32H,12H2,1-2H3,(H,33,37) |
| InChIKey | GEFPESMKSJFYEU-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|