C15H26N2O — CID 20589776
1-cyclohexyl-6-(propan-2-ylamino)-5,6-dihydro-2H-azepin-7-one (PubChem CID 20589776) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is 1-cyclohexyl-6-(propan-2-ylamino)-5,6-dihydro-2H-azepin-7-one.
| Compound Name | 1-cyclohexyl-6-(propan-2-ylamino)-5,6-dihydro-2H-azepin-7-one |
|---|---|
| PubChem CID | 20589776 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | 1-cyclohexyl-6-(propan-2-ylamino)-5,6-dihydro-2H-azepin-7-one |
| SMILES | CC(C)NC1CC=CCN(C2CCCCC2)C1=O |
| InChI | InChI=1S/C15H26N2O/c1-12(2)16-14-10-6-7-11-17(15(14)18)13-8-4-3-5-9-13/h6-7,12-14,16H,3-5,8-11H2,1-2H3 |
| InChIKey | BBXAGKAJWDKJDY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|