C19H19N3O4S — CID 2059292
5-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbonyl)-10-methyl-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-one (PubChem CID 2059292) has the molecular formula C19H19N3O4S and a molecular weight of 385.45 g/mol. Its IUPAC name is 5-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbonyl)-10-methyl-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-one.
| Compound Name | 5-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbonyl)-10-methyl-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-one |
|---|---|
| PubChem CID | 2059292 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 5-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbonyl)-10-methyl-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-one |
| SMILES | Cc1cccn2c(=O)c3cc(C(=O)N4CCC5(CC4)OCCO5)sc3nc12 |
| InChI | InChI=1S/C19H19N3O4S/c1-12-3-2-6-22-15(12)20-16-13(17(22)23)11-14(27-16)18(24)21-7-4-19(5-8-21)25-9-10-26-19/h2-3,6,11H,4-5,7-10H2,1H3 |
| InChIKey | YOCOOKHTUPFDRB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |