C17H19N4O2S+ — CID 3362114
10-methyl-5-(4-methylpiperazin-4-ium-1-carbonyl)-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-one (PubChem CID 3362114) has the molecular formula C17H19N4O2S+ and a molecular weight of 343.43 g/mol. Its IUPAC name is 10-methyl-5-(4-methylpiperazin-4-ium-1-carbonyl)-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-one.
| Compound Name | 10-methyl-5-(4-methylpiperazin-4-ium-1-carbonyl)-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-one |
|---|---|
| PubChem CID | 3362114 |
| Molecular Formula | C17H19N4O2S+ |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 10-methyl-5-(4-methylpiperazin-4-ium-1-carbonyl)-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-one |
| SMILES | Cc1cccn2c(=O)c3cc(C(=O)N4CC[NH+](C)CC4)sc3nc12 |
| InChI | InChI=1S/C17H18N4O2S/c1-11-4-3-5-21-14(11)18-15-12(16(21)22)10-13(24-15)17(23)20-8-6-19(2)7-9-20/h3-5,10H,6-9H2,1-2H3/p+1 |
| InChIKey | CRYRVUAYLNKNKO-UHFFFAOYSA-O |
| XLogP | 0.19 |
| TPSA | 59.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |