C22H14N2O2 — CID 2059749
3-phenacyl-2,3-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,5(16),6,8,10,12,14-heptaen-4-one (PubChem CID 2059749) has the molecular formula C22H14N2O2 and a molecular weight of 338.37 g/mol. Its IUPAC name is 3-phenacyl-2,3-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,5(16),6,8,10,12,14-heptaen-4-one.
| Compound Name | 3-phenacyl-2,3-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,5(16),6,8,10,12,14-heptaen-4-one |
|---|---|
| PubChem CID | 2059749 |
| Molecular Formula | C22H14N2O2 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 3-phenacyl-2,3-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,5(16),6,8,10,12,14-heptaen-4-one |
| SMILES | O=C(Cn1nc2c3c(cccc3c1=O)-c1ccccc1-2)c1ccccc1 |
| InChI | InChI=1S/C22H14N2O2/c25-19(14-7-2-1-3-8-14)13-24-22(26)18-12-6-11-16-15-9-4-5-10-17(15)21(23-24)20(16)18/h1-12H,13H2 |
| InChIKey | ROYXGKIYEYGIRK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |