C34H56F2O — CID 20599654
2-[4-[4-(4,4-difluorobut-3-enyl)cyclohexyl]cyclohexyl]-5-[4-[4-[(E)-prop-1-enyl]cyclohexyl]butyl]oxane (PubChem CID 20599654) has the molecular formula C34H56F2O and a molecular weight of 518.82 g/mol. Its IUPAC name is 2-[4-[4-(4,4-difluorobut-3-enyl)cyclohexyl]cyclohexyl]-5-[4-[4-[(E)-prop-1-enyl]cyclohexyl]butyl]oxane.
| Compound Name | 2-[4-[4-(4,4-difluorobut-3-enyl)cyclohexyl]cyclohexyl]-5-[4-[4-[(E)-prop-1-enyl]cyclohexyl]butyl]oxane |
|---|---|
| PubChem CID | 20599654 |
| Molecular Formula | C34H56F2O |
| Molecular Weight | 518.82 g/mol |
| Exact Mass | 518.43 |
| IUPAC Name | 2-[4-[4-(4,4-difluorobut-3-enyl)cyclohexyl]cyclohexyl]-5-[4-[4-[(E)-prop-1-enyl]cyclohexyl]butyl]oxane |
| SMILES | C/C=C/C1CCC(CCCCC2CCC(C3CCC(C4CCC(CCC=C(F)F)CC4)CC3)OC2)CC1 |
| InChI | InChI=1S/C34H56F2O/c1-2-6-26-11-13-27(14-12-26)7-3-4-8-29-17-24-33(37-25-29)32-22-20-31(21-23-32)30-18-15-28(16-19-30)9-5-10-34(35)36/h2,6,10,26-33H,3-5,7-9,11-25H2,1H3/b6-2+ |
| InChIKey | KXATULCMNSUINO-QHHAFSJGSA-N |
| XLogP | 10.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.82 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|