C10H7NOS — CID 20600357
2-methylfuro[3,2-e][1,3]benzothiazole (PubChem CID 20600357) has the molecular formula C10H7NOS and a molecular weight of 189.24 g/mol. Its IUPAC name is 2-methylfuro[3,2-e][1,3]benzothiazole.
| Compound Name | 2-methylfuro[3,2-e][1,3]benzothiazole |
|---|---|
| PubChem CID | 20600357 |
| Molecular Formula | C10H7NOS |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.02 |
| IUPAC Name | 2-methylfuro[3,2-e][1,3]benzothiazole |
| SMILES | Cc1nc2c(ccc3occc32)s1 |
| InChI | InChI=1S/C10H7NOS/c1-6-11-10-7-4-5-12-8(7)2-3-9(10)13-6/h2-5H,1H3 |
| InChIKey | JXGWTAZXILJVDY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |