C22H37N5O4S — CID 20604018
4-(5-aminopentylsulfamoyl)-N-[[4-(2,2-dimethylpropanoyl)piperazin-1-yl]methyl]benzamide (PubChem CID 20604018) has the molecular formula C22H37N5O4S and a molecular weight of 467.64 g/mol. Its IUPAC name is 4-(5-aminopentylsulfamoyl)-N-[[4-(2,2-dimethylpropanoyl)piperazin-1-yl]methyl]benzamide.
| Compound Name | 4-(5-aminopentylsulfamoyl)-N-[[4-(2,2-dimethylpropanoyl)piperazin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 20604018 |
| Molecular Formula | C22H37N5O4S |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | 4-(5-aminopentylsulfamoyl)-N-[[4-(2,2-dimethylpropanoyl)piperazin-1-yl]methyl]benzamide |
| SMILES | CC(C)(C)C(=O)N1CCN(CNC(=O)c2ccc(S(=O)(=O)NCCCCCN)cc2)CC1 |
| InChI | InChI=1S/C22H37N5O4S/c1-22(2,3)21(29)27-15-13-26(14-16-27)17-24-20(28)18-7-9-19(10-8-18)32(30,31)25-12-6-4-5-11-23/h7-10,25H,4-6,11-17,23H2,1-3H3,(H,24,28) |
| InChIKey | CRBDZKWTZQOYCI-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|