C30H39N3O2 — CID 20604357
1-(2-morpholin-4-ylethyl)-2-phenyl-5-[(1S,2S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]-5,6-dihydro-1,6-naphthyridin-4-one (PubChem CID 20604357) has the molecular formula C30H39N3O2 and a molecular weight of 473.66 g/mol. Its IUPAC name is 1-(2-morpholin-4-ylethyl)-2-phenyl-5-[(1S,2S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]-5,6-dihydro-1,6-naphthyridin-4-one.
| Compound Name | 1-(2-morpholin-4-ylethyl)-2-phenyl-5-[(1S,2S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]-5,6-dihydro-1,6-naphthyridin-4-one |
|---|---|
| PubChem CID | 20604357 |
| Molecular Formula | C30H39N3O2 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.30 |
| IUPAC Name | 1-(2-morpholin-4-ylethyl)-2-phenyl-5-[(1S,2S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]-5,6-dihydro-1,6-naphthyridin-4-one |
| SMILES | CC1(C)C2CC[C@@](C)(C2)[C@@H]1C1NC=Cc2c1c(=O)cc(-c1ccccc1)n2CCN1CCOCC1 |
| InChI | InChI=1S/C30H39N3O2/c1-29(2)22-9-11-30(3,20-22)28(29)27-26-23(10-12-31-27)33(14-13-32-15-17-35-18-16-32)24(19-25(26)34)21-7-5-4-6-8-21/h4-8,10,12,19,22,27-28,31H,9,11,13-18,20H2,1-3H3/t22?,27?,28-,30+/m1/s1 |
| InChIKey | NDABZORGBAJSKZ-ILBGSUSBSA-N |
| XLogP | 4.92 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |