C50H58N2P2Si2 — CID 20606238
N-diphenylphosphanyl-1-[2-(diphenylphosphanylamino)-3-trimethylsilyl-5,6,7,8-tetrahydronaphthalen-1-yl]-3-trimethylsilyl-5,6,7,8-tetrahydronaphthalen-2-amine (PubChem CID 20606238) has the molecular formula C50H58N2P2Si2 and a molecular weight of 805.15 g/mol. Its IUPAC name is N-diphenylphosphanyl-1-[2-(diphenylphosphanylamino)-3-trimethylsilyl-5,6,7,8-tetrahydronaphthalen-1-yl]-3-trimethylsilyl-5,6,7,8-tetrahydronaphthalen-2-amine.
| Compound Name | N-diphenylphosphanyl-1-[2-(diphenylphosphanylamino)-3-trimethylsilyl-5,6,7,8-tetrahydronaphthalen-1-yl]-3-trimethylsilyl-5,6,7,8-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 20606238 |
| Molecular Formula | C50H58N2P2Si2 |
| Molecular Weight | 805.15 g/mol |
| Exact Mass | 804.36 |
| IUPAC Name | N-diphenylphosphanyl-1-[2-(diphenylphosphanylamino)-3-trimethylsilyl-5,6,7,8-tetrahydronaphthalen-1-yl]-3-trimethylsilyl-5,6,7,8-tetrahydronaphthalen-2-amine |
| SMILES | C[Si](C)(C)c1cc2c(c(-c3c4c(cc([Si](C)(C)C)c3NP(c3ccccc3)c3ccccc3)CCCC4)c1NP(c1ccccc1)c1ccccc1)CCCC2 |
| InChI | InChI=1S/C50H58N2P2Si2/c1-55(2,3)45-35-37-23-19-21-33-43(37)47(49(45)51-53(39-25-11-7-12-26-39)40-27-13-8-14-28-40)48-44-34-22-20-24-38(44)36-46(56(4,5)6)50(48)52-54(41-29-15-9-16-30-41)42-31-17-10-18-32-42/h7-18,25-32,35-36,51-52H,19-24,33-34H2,1-6H3 |
| InChIKey | WBGPEBOWABIQNU-UHFFFAOYSA-N |
| XLogP | 11.12 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.15 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|