C12H18N2 — CID 20606384
4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene (PubChem CID 20606384) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene.
| Compound Name | 4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene |
|---|---|
| PubChem CID | 20606384 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene |
| SMILES | C1=CC2C3CNCC3C1C1CNCC21 |
| InChI | InChI=1S/C12H18N2/c1-2-8-11-5-13-3-9(11)7(1)10-4-14-6-12(8)10/h1-2,7-14H,3-6H2 |
| InChIKey | ZGVDOOHKMMAVDD-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|